C21H20N4O3 — CID 13381246
ethyl (6E)-11-oxo-6-(phenylhydrazinylidene)-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-3-carboxylate (PubChem CID 13381246) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is ethyl (6E)-11-oxo-6-(phenylhydrazinylidene)-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-3-carboxylate.
| Compound Name | ethyl (6E)-11-oxo-6-(phenylhydrazinylidene)-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13381246 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | ethyl (6E)-11-oxo-6-(phenylhydrazinylidene)-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(=O)n3c(nc2c1)/C(=N/Nc1ccccc1)CCC3 |
| InChI | InChI=1S/C21H20N4O3/c1-2-28-21(27)14-10-11-16-18(13-14)22-19-17(9-6-12-25(19)20(16)26)24-23-15-7-4-3-5-8-15/h3-5,7-8,10-11,13,23H,2,6,9,12H2,1H3/b24-17+ |
| InChIKey | KLQYTQZWVNIARL-JJIBRWJFSA-N |
| XLogP | 3.18 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|