C13H12N4O3 — CID 70533513
6-hydrazinylidene-11-oxo-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-2-carboxylic acid (PubChem CID 70533513) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-hydrazinylidene-11-oxo-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-2-carboxylic acid.
| Compound Name | 6-hydrazinylidene-11-oxo-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 70533513 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 6-hydrazinylidene-11-oxo-8,9-dihydro-7H-pyrido[2,1-b]quinazoline-2-carboxylic acid |
| SMILES | NN=C1CCCn2c1nc1ccc(C(=O)O)cc1c2=O |
| InChI | InChI=1S/C13H12N4O3/c14-16-10-2-1-5-17-11(10)15-9-4-3-7(13(19)20)6-8(9)12(17)18/h3-4,6H,1-2,5,14H2,(H,19,20) |
| InChIKey | QOTZOTLWSJNVOS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|