C19H16N4O3 — CID 13381249
(4E)-4-(phenylhydrazinylidene)-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,10,12(16)-tetraen-9-one (PubChem CID 13381249) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is (4E)-4-(phenylhydrazinylidene)-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,10,12(16)-tetraen-9-one.
| Compound Name | (4E)-4-(phenylhydrazinylidene)-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,10,12(16)-tetraen-9-one |
|---|---|
| PubChem CID | 13381249 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (4E)-4-(phenylhydrazinylidene)-13,15-dioxa-2,8-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,10,12(16)-tetraen-9-one |
| SMILES | O=c1c2cc3c(cc2nc2n1CCC/C2=N\Nc1ccccc1)OCO3 |
| InChI | InChI=1S/C19H16N4O3/c24-19-13-9-16-17(26-11-25-16)10-15(13)20-18-14(7-4-8-23(18)19)22-21-12-5-2-1-3-6-12/h1-3,5-6,9-10,21H,4,7-8,11H2/b22-14+ |
| InChIKey | WMDOIDHJGCKLOA-HYARGMPZSA-N |
| XLogP | 2.74 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|