C17H23N5O6S — CID 34095651
1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-4-(3-methyl-5-nitroimidazol-4-yl)piperazine (PubChem CID 34095651) has the molecular formula C17H23N5O6S and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-4-(3-methyl-5-nitroimidazol-4-yl)piperazine.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-4-(3-methyl-5-nitroimidazol-4-yl)piperazine |
|---|---|
| PubChem CID | 34095651 |
| Molecular Formula | C17H23N5O6S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)sulfonyl-4-(3-methyl-5-nitroimidazol-4-yl)piperazine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCN(c3c([N+](=O)[O-])ncn3C)CC2)cc1OC |
| InChI | InChI=1S/C17H23N5O6S/c1-12-9-13(27-3)14(28-4)10-15(12)29(25,26)21-7-5-20(6-8-21)17-16(22(23)24)18-11-19(17)2/h9-11H,5-8H2,1-4H3 |
| InChIKey | CNBREYVZYSJMSB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|