C26H36ClN5O2S — CID 3409772
4-[[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 3409772) has the molecular formula C26H36ClN5O2S and a molecular weight of 518.13 g/mol. Its IUPAC name is 4-[[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-[[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 3409772 |
| Molecular Formula | C26H36ClN5O2S |
| Molecular Weight | 518.13 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 4-[[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanylmethyl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CN(c1cc(Cl)nc(SCc2ccc(C(=O)NCCCN3CCOCC3)cc2)n1)C1CCCCC1 |
| InChI | InChI=1S/C26H36ClN5O2S/c1-31(22-6-3-2-4-7-22)24-18-23(27)29-26(30-24)35-19-20-8-10-21(11-9-20)25(33)28-12-5-13-32-14-16-34-17-15-32/h8-11,18,22H,2-7,12-17,19H2,1H3,(H,28,33) |
| InChIKey | POUQVEVOZGWMHQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.13 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|