C25H32ClN5OS — CID 4010736
4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 4010736) has the molecular formula C25H32ClN5OS and a molecular weight of 486.09 g/mol. Its IUPAC name is 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 4010736 |
| Molecular Formula | C25H32ClN5OS |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCc2ccc(C(=O)NCCN3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C25H32ClN5OS/c1-3-13-31(14-4-2)23-18-22(26)28-25(29-23)33-19-20-8-10-21(11-9-20)24(32)27-12-17-30-15-6-5-7-16-30/h3-4,8-11,18H,1-2,5-7,12-17,19H2,(H,27,32) |
| InChIKey | GYAQJPVDZPGYKQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|