C22H27ClN4OS — CID 3292001
4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butan-2-ylbenzamide (PubChem CID 3292001) has the molecular formula C22H27ClN4OS and a molecular weight of 431.01 g/mol. Its IUPAC name is 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butan-2-ylbenzamide.
| Compound Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butan-2-ylbenzamide |
|---|---|
| PubChem CID | 3292001 |
| Molecular Formula | C22H27ClN4OS |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-butan-2-ylbenzamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCc2ccc(C(=O)NC(C)CC)cc2)n1 |
| InChI | InChI=1S/C22H27ClN4OS/c1-5-12-27(13-6-2)20-14-19(23)25-22(26-20)29-15-17-8-10-18(11-9-17)21(28)24-16(4)7-3/h5-6,8-11,14,16H,1-2,7,12-13,15H2,3-4H3,(H,24,28) |
| InChIKey | ODBXZGRLYXRZRH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|