C26H27ClN4OS — CID 3966326
3-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(1-phenylethyl)benzamide (PubChem CID 3966326) has the molecular formula C26H27ClN4OS and a molecular weight of 479.05 g/mol. Its IUPAC name is 3-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3966326 |
| Molecular Formula | C26H27ClN4OS |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 3-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(1-phenylethyl)benzamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCc2cccc(C(=O)NC(C)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C26H27ClN4OS/c1-4-14-31(15-5-2)24-17-23(27)29-26(30-24)33-18-20-10-9-13-22(16-20)25(32)28-19(3)21-11-7-6-8-12-21/h4-13,16-17,19H,1-2,14-15,18H2,3H3,(H,28,32) |
| InChIKey | PYLPJFZVSNXAEF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|