C24H31ClN4OS — CID 3907363
4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide (PubChem CID 3907363) has the molecular formula C24H31ClN4OS and a molecular weight of 459.06 g/mol. Its IUPAC name is 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide.
| Compound Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 3907363 |
| Molecular Formula | C24H31ClN4OS |
| Molecular Weight | 459.06 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-hexylbenzamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCc2ccc(C(=O)NCCCCCC)cc2)n1 |
| InChI | InChI=1S/C24H31ClN4OS/c1-4-7-8-9-14-26-23(30)20-12-10-19(11-13-20)18-31-24-27-21(25)17-22(28-24)29(15-5-2)16-6-3/h5-6,10-13,17H,2-4,7-9,14-16,18H2,1H3,(H,26,30) |
| InChIKey | KSYYBBHHVJPMDC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.06 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|