C25H26ClN5OS — CID 42764565
4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 42764565) has the molecular formula C25H26ClN5OS and a molecular weight of 480.04 g/mol. Its IUPAC name is 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 42764565 |
| Molecular Formula | C25H26ClN5OS |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-[[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCc2ccc(C(=O)NCCc3ccccn3)cc2)n1 |
| InChI | InChI=1S/C25H26ClN5OS/c1-3-15-31(16-4-2)23-17-22(26)29-25(30-23)33-18-19-8-10-20(11-9-19)24(32)28-14-12-21-7-5-6-13-27-21/h3-11,13,17H,1-2,12,14-16,18H2,(H,28,32) |
| InChIKey | AFDGNLNGXULWGF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|