C20H18ClFN4OS — CID 3640235
3-[[4-chloro-6-(dimethylamino)pyrimidin-2-yl]sulfanylmethyl]-N-(4-fluorophenyl)benzamide (PubChem CID 3640235) has the molecular formula C20H18ClFN4OS and a molecular weight of 416.91 g/mol. Its IUPAC name is 3-[[4-chloro-6-(dimethylamino)pyrimidin-2-yl]sulfanylmethyl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[[4-chloro-6-(dimethylamino)pyrimidin-2-yl]sulfanylmethyl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 3640235 |
| Molecular Formula | C20H18ClFN4OS |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-[[4-chloro-6-(dimethylamino)pyrimidin-2-yl]sulfanylmethyl]-N-(4-fluorophenyl)benzamide |
| SMILES | CN(C)c1cc(Cl)nc(SCc2cccc(C(=O)Nc3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C20H18ClFN4OS/c1-26(2)18-11-17(21)24-20(25-18)28-12-13-4-3-5-14(10-13)19(27)23-16-8-6-15(22)7-9-16/h3-11H,12H2,1-2H3,(H,23,27) |
| InChIKey | MWUAEWNQJPTHTF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |