C17H27ClN4O2S — CID 4543620
2-[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 4543620) has the molecular formula C17H27ClN4O2S and a molecular weight of 386.95 g/mol. Its IUPAC name is 2-[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 4543620 |
| Molecular Formula | C17H27ClN4O2S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[4-chloro-6-[cyclohexyl(methyl)amino]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc(Cl)cc(N(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C17H27ClN4O2S/c1-22(13-7-4-3-5-8-13)15-11-14(18)20-17(21-15)25-12-16(23)19-9-6-10-24-2/h11,13H,3-10,12H2,1-2H3,(H,19,23) |
| InChIKey | MPKDEPGNIZVSLI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|