C15H12N4O2S2 — CID 34111095
[4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)phenyl]urea (PubChem CID 34111095) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is [4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)phenyl]urea.
| Compound Name | [4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)phenyl]urea |
|---|---|
| PubChem CID | 34111095 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(=O)CSc2ncnc3ccsc23)cc1 |
| InChI | InChI=1S/C15H12N4O2S2/c16-15(21)19-10-3-1-9(2-4-10)12(20)7-23-14-13-11(5-6-22-13)17-8-18-14/h1-6,8H,7H2,(H3,16,19,21) |
| InChIKey | MYNIHNQEOVYMPC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |