C16H14N4O2S2 — CID 51280442
4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide (PubChem CID 51280442) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide.
| Compound Name | 4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 51280442 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide |
| SMILES | CC(Sc1ncnc2ccsc12)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H14N4O2S2/c1-9(24-16-13-12(6-7-23-13)18-8-19-16)15(22)20-11-4-2-10(3-5-11)14(17)21/h2-9H,1H3,(H2,17,21)(H,20,22) |
| InChIKey | DVBUSRGRMSSOCA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |