C16H16N4O3S — CID 34113136
4-methoxy-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]benzenesulfonamide (PubChem CID 34113136) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-methoxy-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34113136 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-methoxy-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccnc(-n3cccn3)c2)cc1 |
| InChI | InChI=1S/C16H16N4O3S/c1-23-14-3-5-15(6-4-14)24(21,22)19-12-13-7-9-17-16(11-13)20-10-2-8-18-20/h2-11,19H,12H2,1H3 |
| InChIKey | QIAGTOMXRZLGPJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |