C27H24N2O5 — CID 3413502
2-(2H-chromen-3-yl)-N,1-bis(3-methoxyphenyl)-4-oxoazetidine-2-carboxamide (PubChem CID 3413502) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-(2H-chromen-3-yl)-N,1-bis(3-methoxyphenyl)-4-oxoazetidine-2-carboxamide.
| Compound Name | 2-(2H-chromen-3-yl)-N,1-bis(3-methoxyphenyl)-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3413502 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-(2H-chromen-3-yl)-N,1-bis(3-methoxyphenyl)-4-oxoazetidine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)C2(C3=Cc4ccccc4OC3)CC(=O)N2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C27H24N2O5/c1-32-22-10-5-8-20(14-22)28-26(31)27(19-13-18-7-3-4-12-24(18)34-17-19)16-25(30)29(27)21-9-6-11-23(15-21)33-2/h3-15H,16-17H2,1-2H3,(H,28,31) |
| InChIKey | FPYBPGAYZCFBRT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |