C28H29ClN2O8 — CID 3729921
2-(2-chlorophenyl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide (PubChem CID 3729921) has the molecular formula C28H29ClN2O8 and a molecular weight of 557.00 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 3729921 |
| Molecular Formula | C28H29ClN2O8 |
| Molecular Weight | 557.00 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 2-(2-chlorophenyl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2(c3ccccc3Cl)CC(=O)N2c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H29ClN2O8/c1-34-20-11-16(12-21(35-2)25(20)38-5)30-27(33)28(18-9-7-8-10-19(18)29)15-24(32)31(28)17-13-22(36-3)26(39-6)23(14-17)37-4/h7-14H,15H2,1-6H3,(H,30,33) |
| InChIKey | RZTLXMRPPONLES-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.00 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |