C31H32N2O9 — CID 3778887
2-(2H-chromen-3-yl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide (PubChem CID 3778887) has the molecular formula C31H32N2O9 and a molecular weight of 576.60 g/mol. Its IUPAC name is 2-(2H-chromen-3-yl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide.
| Compound Name | 2-(2H-chromen-3-yl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 3778887 |
| Molecular Formula | C31H32N2O9 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-(2H-chromen-3-yl)-4-oxo-N,1-bis(3,4,5-trimethoxyphenyl)azetidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2(C3=Cc4ccccc4OC3)CC(=O)N2c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C31H32N2O9/c1-36-23-12-20(13-24(37-2)28(23)40-5)32-30(35)31(19-11-18-9-7-8-10-22(18)42-17-19)16-27(34)33(31)21-14-25(38-3)29(41-6)26(15-21)39-4/h7-15H,16-17H2,1-6H3,(H,32,35) |
| InChIKey | PADHOACEMXZAML-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |