C20H20N6O2S2 — CID 3416137
N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-2-(propan-2-ylideneamino)oxypropanamide (PubChem CID 3416137) has the molecular formula C20H20N6O2S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-2-(propan-2-ylideneamino)oxypropanamide.
| Compound Name | N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-2-(propan-2-ylideneamino)oxypropanamide |
|---|---|
| PubChem CID | 3416137 |
| Molecular Formula | C20H20N6O2S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-2-(propan-2-ylideneamino)oxypropanamide |
| SMILES | CC(C)=NOC(C)C(=O)Nc1ccc2nc(SCn3nnc4ccccc43)sc2c1 |
| InChI | InChI=1S/C20H20N6O2S2/c1-12(2)24-28-13(3)19(27)21-14-8-9-16-18(10-14)30-20(22-16)29-11-26-17-7-5-4-6-15(17)23-25-26/h4-10,13H,11H2,1-3H3,(H,21,27) |
| InChIKey | ZYDFJWYGJAWBJM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|