C21H18N8O3S2 — CID 5019372
N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide (PubChem CID 5019372) has the molecular formula C21H18N8O3S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide.
| Compound Name | N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 5019372 |
| Molecular Formula | C21H18N8O3S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[2-(benzotriazol-1-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCC(=O)Nc1ccc2nc(SCn3nnc4ccccc43)sc2c1 |
| InChI | InChI=1S/C21H18N8O3S2/c1-13-22-19(29(31)32)11-27(13)9-8-20(30)23-14-6-7-16-18(10-14)34-21(24-16)33-12-28-17-5-3-2-4-15(17)25-26-28/h2-7,10-11H,8-9,12H2,1H3,(H,23,30) |
| InChIKey | PQAWAYUPRNHHFV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|