C20H23N5O3S2 — CID 3447466
prop-2-enyl N-[2-[[6-[3-(2-methylimidazol-1-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 3447466) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is prop-2-enyl N-[2-[[6-[3-(2-methylimidazol-1-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[[6-[3-(2-methylimidazol-1-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 3447466 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | prop-2-enyl N-[2-[[6-[3-(2-methylimidazol-1-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCSc1nc2ccc(NC(=O)CCn3ccnc3C)cc2s1 |
| InChI | InChI=1S/C20H23N5O3S2/c1-3-11-28-19(27)22-8-12-29-20-24-16-5-4-15(13-17(16)30-20)23-18(26)6-9-25-10-7-21-14(25)2/h3-5,7,10,13H,1,6,8-9,11-12H2,2H3,(H,22,27)(H,23,26) |
| InChIKey | GKQPCSNQLGRQJY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|