C23H21N3O4S2 — CID 3869474
prop-2-enyl N-[2-[[6-[(3-oxo-1,2-dihydroindene-1-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 3869474) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is prop-2-enyl N-[2-[[6-[(3-oxo-1,2-dihydroindene-1-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[[6-[(3-oxo-1,2-dihydroindene-1-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 3869474 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | prop-2-enyl N-[2-[[6-[(3-oxo-1,2-dihydroindene-1-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCSc1nc2ccc(NC(=O)C3CC(=O)c4ccccc43)cc2s1 |
| InChI | InChI=1S/C23H21N3O4S2/c1-2-10-30-22(29)24-9-11-31-23-26-18-8-7-14(12-20(18)32-23)25-21(28)17-13-19(27)16-6-4-3-5-15(16)17/h2-8,12,17H,1,9-11,13H2,(H,24,29)(H,25,28) |
| InChIKey | COKSTBSCNJOXOV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|