C21H21N3O5S3 — CID 3860840
prop-2-enyl N-[2-[[6-[(2-methylsulfonylbenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 3860840) has the molecular formula C21H21N3O5S3 and a molecular weight of 491.62 g/mol. Its IUPAC name is prop-2-enyl N-[2-[[6-[(2-methylsulfonylbenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[[6-[(2-methylsulfonylbenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 3860840 |
| Molecular Formula | C21H21N3O5S3 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | prop-2-enyl N-[2-[[6-[(2-methylsulfonylbenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCSc1nc2ccc(NC(=O)c3ccccc3S(C)(=O)=O)cc2s1 |
| InChI | InChI=1S/C21H21N3O5S3/c1-3-11-29-20(26)22-10-12-30-21-24-16-9-8-14(13-17(16)31-21)23-19(25)15-6-4-5-7-18(15)32(2,27)28/h3-9,13H,1,10-12H2,2H3,(H,22,26)(H,23,25) |
| InChIKey | CZSYIKURPASDRH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|