C22H23N3O5S3 — CID 3447477
prop-2-enyl N-[2-[[6-[[2-(4-methylphenyl)sulfonylacetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 3447477) has the molecular formula C22H23N3O5S3 and a molecular weight of 505.64 g/mol. Its IUPAC name is prop-2-enyl N-[2-[[6-[[2-(4-methylphenyl)sulfonylacetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[[6-[[2-(4-methylphenyl)sulfonylacetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 3447477 |
| Molecular Formula | C22H23N3O5S3 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | prop-2-enyl N-[2-[[6-[[2-(4-methylphenyl)sulfonylacetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCSc1nc2ccc(NC(=O)CS(=O)(=O)c3ccc(C)cc3)cc2s1 |
| InChI | InChI=1S/C22H23N3O5S3/c1-3-11-30-21(27)23-10-12-31-22-25-18-9-6-16(13-19(18)32-22)24-20(26)14-33(28,29)17-7-4-15(2)5-8-17/h3-9,13H,1,10-12,14H2,2H3,(H,23,27)(H,24,26) |
| InChIKey | XAZCYJYGGBJNRO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|