C23H23N3O4S2 — CID 3861360
2-[[6-[(1-benzyl-5-oxopyrrolidine-2-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate (PubChem CID 3861360) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[[6-[(1-benzyl-5-oxopyrrolidine-2-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate.
| Compound Name | 2-[[6-[(1-benzyl-5-oxopyrrolidine-2-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 3861360 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-[[6-[(1-benzyl-5-oxopyrrolidine-2-carbonyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSc1nc2ccc(NC(=O)C3CCC(=O)N3Cc3ccccc3)cc2s1 |
| InChI | InChI=1S/C23H23N3O4S2/c1-15(27)30-11-12-31-23-25-18-8-7-17(13-20(18)32-23)24-22(29)19-9-10-21(28)26(19)14-16-5-3-2-4-6-16/h2-8,13,19H,9-12,14H2,1H3,(H,24,29) |
| InChIKey | LLFSAIMEYIRVCE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|