C21H19N3O5S2 — CID 3852838
2-[[6-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate (PubChem CID 3852838) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[[6-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate.
| Compound Name | 2-[[6-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 3852838 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[[6-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]-1,3-benzothiazol-2-yl]sulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSc1nc2ccc(NC(=O)CCn3c(=O)oc4ccccc43)cc2s1 |
| InChI | InChI=1S/C21H19N3O5S2/c1-13(25)28-10-11-30-20-23-15-7-6-14(12-18(15)31-20)22-19(26)8-9-24-16-4-2-3-5-17(16)29-21(24)27/h2-7,12H,8-11H2,1H3,(H,22,26) |
| InChIKey | BLIKHARJRULCQA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|