C17H10Cl3N3O2S — CID 3416199
N-[5-acetyl-3-(2,4,5-trichlorophenyl)-1,3,4-thiadiazol-2-ylidene]benzamide (PubChem CID 3416199) has the molecular formula C17H10Cl3N3O2S and a molecular weight of 426.71 g/mol. Its IUPAC name is N-[5-acetyl-3-(2,4,5-trichlorophenyl)-1,3,4-thiadiazol-2-ylidene]benzamide.
| Compound Name | N-[5-acetyl-3-(2,4,5-trichlorophenyl)-1,3,4-thiadiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3416199 |
| Molecular Formula | C17H10Cl3N3O2S |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | N-[5-acetyl-3-(2,4,5-trichlorophenyl)-1,3,4-thiadiazol-2-ylidene]benzamide |
| SMILES | CC(=O)c1nn(-c2cc(Cl)c(Cl)cc2Cl)/c(=N/C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C17H10Cl3N3O2S/c1-9(24)16-22-23(14-8-12(19)11(18)7-13(14)20)17(26-16)21-15(25)10-5-3-2-4-6-10/h2-8H,1H3/b21-17- |
| InChIKey | LIYYELXIAOBAOS-FXBPSFAMSA-N |
| XLogP | 4.84 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|