C16H12ClN3O3 — CID 34163636
methyl 2-chloro-5-(1H-indazole-7-carbonylamino)benzoate (PubChem CID 34163636) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is methyl 2-chloro-5-(1H-indazole-7-carbonylamino)benzoate.
| Compound Name | methyl 2-chloro-5-(1H-indazole-7-carbonylamino)benzoate |
|---|---|
| PubChem CID | 34163636 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 2-chloro-5-(1H-indazole-7-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cccc3cn[nH]c23)ccc1Cl |
| InChI | InChI=1S/C16H12ClN3O3/c1-23-16(22)12-7-10(5-6-13(12)17)19-15(21)11-4-2-3-9-8-18-20-14(9)11/h2-8H,1H3,(H,18,20)(H,19,21) |
| InChIKey | ZFXTWCSBYKFPKQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |