C19H20N4O2 — CID 43052510
N-[3-(diethylcarbamoyl)phenyl]-1H-indazole-7-carboxamide (PubChem CID 43052510) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-1H-indazole-7-carboxamide.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 43052510 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-1H-indazole-7-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cccc3cn[nH]c23)c1 |
| InChI | InChI=1S/C19H20N4O2/c1-3-23(4-2)19(25)13-7-5-9-15(11-13)21-18(24)16-10-6-8-14-12-20-22-17(14)16/h5-12H,3-4H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | VLKYDMCSOJLWHL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |