C14H9Cl2N3O — CID 43048604
N-(3,4-dichlorophenyl)-1H-indazole-7-carboxamide (PubChem CID 43048604) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1H-indazole-7-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 43048604 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1H-indazole-7-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-11-5-4-9(6-12(11)16)18-14(20)10-3-1-2-8-7-17-19-13(8)10/h1-7H,(H,17,19)(H,18,20) |
| InChIKey | GKKOXTWGHBGBLP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |