C14H15ClFN5OS — CID 3417194
2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone (PubChem CID 3417194) has the molecular formula C14H15ClFN5OS and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 3417194 |
| Molecular Formula | C14H15ClFN5OS |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc(F)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H15ClFN5OS/c15-11-8-10(4-5-12(11)16)21-14(17-18-19-21)23-9-13(22)20-6-2-1-3-7-20/h4-5,8H,1-3,6-7,9H2 |
| InChIKey | NWRYXDDZFXGBIA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |