C37H48F3NO3 — CID 3417822
[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3417822) has the molecular formula C37H48F3NO3 and a molecular weight of 611.79 g/mol. Its IUPAC name is [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3417822 |
| Molecular Formula | C37H48F3NO3 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCCCCC1 |
| InChI | InChI=1S/C37H48F3NO3/c1-32-14-11-27(42)22-34(32)17-18-36(28(23-34)31(43)25-9-8-10-26(21-25)37(38,39)40)29(32)12-15-33(2)30(36)13-16-35(33,44)24-41-19-6-4-3-5-7-20-41/h8-10,17-18,21,23,27,29-30,42,44H,3-7,11-16,19-20,22,24H2,1-2H3 |
| InChIKey | QHPVHNMRFNVCOE-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|