About (4S)-4-chloro-5,5-dimethylhexanoyl chloride
(4S)-4-chloro-5,5-dimethylhexanoyl chloride (PubChem CID 34181516) has the molecular formula C8H14Cl2O
and a molecular weight of 197.10 g/mol. Its IUPAC name is (4S)-4-chloro-5,5-dimethylhexanoyl chloride.
Molecular Properties
| Compound Name | (4S)-4-chloro-5,5-dimethylhexanoyl chloride |
| PubChem CID | 34181516 |
| Molecular Formula | C8H14Cl2O |
| Molecular Weight | 197.10 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (4S)-4-chloro-5,5-dimethylhexanoyl chloride |
| SMILES | CC(C)(C)[C@@H](Cl)CCC(=O)Cl |
| InChI | InChI=1S/C8H14Cl2O/c1-8(2,3)6(9)4-5-7(10)11/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | YLEUFFLCXANONG-LURJTMIESA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-chloro-5,5-dimethylhexanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-chloro-5,5-dimethylhexanoyl chloride?
The IUPAC name of (4S)-4-chloro-5,5-dimethylhexanoyl chloride (CID 34181516) is (4S)-4-chloro-5,5-dimethylhexanoyl chloride.
What is the SMILES notation for (4S)-4-chloro-5,5-dimethylhexanoyl chloride?
The canonical SMILES for (4S)-4-chloro-5,5-dimethylhexanoyl chloride is CC(C)(C)[C@@H](Cl)CCC(=O)Cl.
What is the InChIKey of (4S)-4-chloro-5,5-dimethylhexanoyl chloride?
The InChIKey is YLEUFFLCXANONG-LURJTMIESA-N. The full InChI is InChI=1S/C8H14Cl2O/c1-8(2,3)6(9)4-5-7(10)11/h6H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of (4S)-4-chloro-5,5-dimethylhexanoyl chloride?
(4S)-4-chloro-5,5-dimethylhexanoyl chloride has a molecular weight of 197.10 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-chloro-5,5-dimethylhexanoyl chloride is sourced from PubChem (CID 34181516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).