C6H5Cl3O3 — CID 87502873
propane-1,1,3-tricarbonyl chloride (PubChem CID 87502873) has the molecular formula C6H5Cl3O3 and a molecular weight of 231.46 g/mol. Its IUPAC name is propane-1,1,3-tricarbonyl chloride.
| Compound Name | propane-1,1,3-tricarbonyl chloride |
|---|---|
| PubChem CID | 87502873 |
| Molecular Formula | C6H5Cl3O3 |
| Molecular Weight | 231.46 g/mol |
| Exact Mass | 229.93 |
| IUPAC Name | propane-1,1,3-tricarbonyl chloride |
| SMILES | O=C(Cl)CCC(C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C6H5Cl3O3/c7-4(10)2-1-3(5(8)11)6(9)12/h3H,1-2H2 |
| InChIKey | NXDOISJCODNKKE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|