About 2,4-dinitroheptanedioyl dichloride
2,4-dinitroheptanedioyl dichloride (PubChem CID 57288907) has the molecular formula C7H8Cl2N2O6
and a molecular weight of 287.06 g/mol. Its IUPAC name is 2,4-dinitroheptanedioyl dichloride.
Molecular Properties
| Compound Name | 2,4-dinitroheptanedioyl dichloride |
| PubChem CID | 57288907 |
| Molecular Formula | C7H8Cl2N2O6 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2,4-dinitroheptanedioyl dichloride |
| SMILES | O=C(Cl)CCC(CC(C(=O)Cl)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H8Cl2N2O6/c8-6(12)2-1-4(10(14)15)3-5(7(9)13)11(16)17/h4-5H,1-3H2 |
| InChIKey | GQLYNBGDRUVLOX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitroheptanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitroheptanedioyl dichloride?
The IUPAC name of 2,4-dinitroheptanedioyl dichloride (CID 57288907) is 2,4-dinitroheptanedioyl dichloride.
What is the SMILES notation for 2,4-dinitroheptanedioyl dichloride?
The canonical SMILES for 2,4-dinitroheptanedioyl dichloride is O=C(Cl)CCC(CC(C(=O)Cl)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2,4-dinitroheptanedioyl dichloride?
The InChIKey is GQLYNBGDRUVLOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2O6/c8-6(12)2-1-4(10(14)15)3-5(7(9)13)11(16)17/h4-5H,1-3H2.
What are the key properties of 2,4-dinitroheptanedioyl dichloride?
2,4-dinitroheptanedioyl dichloride has a molecular weight of 287.06 g/mol, XLogP of 0.98, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitroheptanedioyl dichloride is sourced from PubChem (CID 57288907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).