C9H17NO4 — CID 155908639
(5S,8S)-8-hydroxy-5-nitrononan-2-one (PubChem CID 155908639) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (5S,8S)-8-hydroxy-5-nitrononan-2-one.
| Compound Name | (5S,8S)-8-hydroxy-5-nitrononan-2-one |
|---|---|
| PubChem CID | 155908639 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (5S,8S)-8-hydroxy-5-nitrononan-2-one |
| SMILES | CC(=O)CC[C@H](CC[C@H](C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-7(11)3-5-9(10(13)14)6-4-8(2)12/h7,9,11H,3-6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | RUKZNVUNYWBTLV-CBAPKCEASA-N |
| XLogP | 1.16 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|