About 6-nitroheptane-2,5-dione
6-nitroheptane-2,5-dione (PubChem CID 15176516) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is 6-nitroheptane-2,5-dione.
Molecular Properties
| Compound Name | 6-nitroheptane-2,5-dione |
| PubChem CID | 15176516 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 6-nitroheptane-2,5-dione |
| SMILES | CC(=O)CCC(=O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H11NO4/c1-5(9)3-4-7(10)6(2)8(11)12/h6H,3-4H2,1-2H3 |
| InChIKey | NINADHMRCCNRID-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitroheptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitroheptane-2,5-dione?
The IUPAC name of 6-nitroheptane-2,5-dione (CID 15176516) is 6-nitroheptane-2,5-dione.
What is the SMILES notation for 6-nitroheptane-2,5-dione?
The canonical SMILES for 6-nitroheptane-2,5-dione is CC(=O)CCC(=O)C(C)[N+](=O)[O-].
What is the InChIKey of 6-nitroheptane-2,5-dione?
The InChIKey is NINADHMRCCNRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-5(9)3-4-7(10)6(2)8(11)12/h6H,3-4H2,1-2H3.
What are the key properties of 6-nitroheptane-2,5-dione?
6-nitroheptane-2,5-dione has a molecular weight of 173.17 g/mol, XLogP of 0.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitroheptane-2,5-dione is sourced from PubChem (CID 15176516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).