C8H13NO4 — CID 11019598
4-nitrooctane-2,7-dione (PubChem CID 11019598) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 4-nitrooctane-2,7-dione.
| Compound Name | 4-nitrooctane-2,7-dione |
|---|---|
| PubChem CID | 11019598 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-nitrooctane-2,7-dione |
| SMILES | CC(=O)CCC(CC(C)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO4/c1-6(10)3-4-8(9(12)13)5-7(2)11/h8H,3-5H2,1-2H3 |
| InChIKey | JGNFTKROTUHPPN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|