C6H12N2O6 — CID 92543376
(2S,5R)-2,5-dinitrohexane-1,6-diol (PubChem CID 92543376) has the molecular formula C6H12N2O6 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2S,5R)-2,5-dinitrohexane-1,6-diol.
| Compound Name | (2S,5R)-2,5-dinitrohexane-1,6-diol |
|---|---|
| PubChem CID | 92543376 |
| Molecular Formula | C6H12N2O6 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2S,5R)-2,5-dinitrohexane-1,6-diol |
| SMILES | O=[N+]([O-])[C@H](CO)CC[C@H](CO)[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N2O6/c9-3-5(7(11)12)1-2-6(4-10)8(13)14/h5-6,9-10H,1-4H2/t5-,6+ |
| InChIKey | DTJWQPZKFAIYFF-OLQVQODUSA-N |
| XLogP | -0.96 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|