C12H30N6O8Pt2-2 — CID 133065575
platinum;2,5,8,11-tetraaminododecane-1,12-diol;dinitrate (PubChem CID 133065575) has the molecular formula C12H30N6O8Pt2-2 and a molecular weight of 776.56 g/mol. Its IUPAC name is platinum;2,5,8,11-tetraaminododecane-1,12-diol;dinitrate.
| Compound Name | platinum;2,5,8,11-tetraaminododecane-1,12-diol;dinitrate |
|---|---|
| PubChem CID | 133065575 |
| Molecular Formula | C12H30N6O8Pt2-2 |
| Molecular Weight | 776.56 g/mol |
| Exact Mass | 776.14 |
| IUPAC Name | platinum;2,5,8,11-tetraaminododecane-1,12-diol;dinitrate |
| SMILES | NC(CO)CCC(N)CCC(N)CCC(N)CO.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Pt].[Pt] |
| InChI | InChI=1S/C12H30N4O2.2NO3.2Pt/c13-9(3-5-11(15)7-17)1-2-10(14)4-6-12(16)8-18;2*2-1(3)4;;/h9-12,17-18H,1-8,13-16H2;;;;/q;2*-1;; |
| InChIKey | IJASMXYDCMLPPW-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 276.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.56 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|