4-amino-5-hydroxypentanoic acid

C10H22N2O6 — CID 162240530

IUPAC4-amino-5-hydroxypentanoic acid
SMILESNC(CO)CCC(=O)O.NC(CO)CCC(=O)O
InChIInChI=1S/2C5H11NO3/c2*6-4(3-7)1-2-5(8)9/h2*4,7H,1-3,6H2,(H,8,9)
InChIKeyZWQFEADGMAIGCG-UHFFFAOYSA-N
MW266.29 g/mol
LogP-1.66
Rot. Bonds8

About 4-amino-5-hydroxypentanoic acid

4-amino-5-hydroxypentanoic acid (PubChem CID 162240530) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-amino-5-hydroxypentanoic acid.

Molecular Properties

Compound Name4-amino-5-hydroxypentanoic acid
PubChem CID162240530
Molecular FormulaC10H22N2O6
Molecular Weight266.29 g/mol
Exact Mass266.15
IUPAC Name4-amino-5-hydroxypentanoic acid
SMILESNC(CO)CCC(=O)O.NC(CO)CCC(=O)O
InChIInChI=1S/2C5H11NO3/c2*6-4(3-7)1-2-5(8)9/h2*4,7H,1-3,6H2,(H,8,9)
InChIKeyZWQFEADGMAIGCG-UHFFFAOYSA-N
XLogP-1.66
TPSA167.10 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500266.29
LogP ≤ 5-1.66
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze 4-amino-5-hydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4,9-diaminononanoic acid
CID 88791042
(4R)-4-amino-6-methylheptanoic acid;hydrochloride
CID 46218148
4-[[(5S)-5-amino-6-hydroxyhexyl]amino]-4-oxobutanoic acid
CID 131955130
(2R)-2-amino(1,2,3,4,5-13C5)pentanedioic acid
CID 121494059
4-amino-4-hydroxybutanoic acid;palladium
CID 87204989
2-aminopentanedioic acid
CID 611
4-amino-4-fluorobutanoic acid
CID 20508342
4-aminoicosanoic acid
CID 57269724
4-aminooctadecanoic acid
CID 154390224
4-amino-7-ethoxy-7-oxoheptanoic acid
CID 87355046
(4S)-4-amino-4-cyclopropylbutanoic acid
CID 55291872
(3-amino-4-hydroxybutyl)carbamic acid
CID 129243477

Frequently Asked Questions

What is the IUPAC name of 4-amino-5-hydroxypentanoic acid?
The IUPAC name of 4-amino-5-hydroxypentanoic acid (CID 162240530) is 4-amino-5-hydroxypentanoic acid.
What is the SMILES notation for 4-amino-5-hydroxypentanoic acid?
The canonical SMILES for 4-amino-5-hydroxypentanoic acid is NC(CO)CCC(=O)O.NC(CO)CCC(=O)O.
What is the InChIKey of 4-amino-5-hydroxypentanoic acid?
The InChIKey is ZWQFEADGMAIGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO3/c2*6-4(3-7)1-2-5(8)9/h2*4,7H,1-3,6H2,(H,8,9).
What are the key properties of 4-amino-5-hydroxypentanoic acid?
4-amino-5-hydroxypentanoic acid has a molecular weight of 266.29 g/mol, XLogP of -1.66, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-hydroxypentanoic acid is sourced from PubChem (CID 162240530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).