About 4-amino-4-fluorobutanoic acid
4-amino-4-fluorobutanoic acid (PubChem CID 20508342) has the molecular formula C4H8FNO2
and a molecular weight of 121.11 g/mol. Its IUPAC name is 4-amino-4-fluorobutanoic acid.
Molecular Properties
| Compound Name | 4-amino-4-fluorobutanoic acid |
| PubChem CID | 20508342 |
| Molecular Formula | C4H8FNO2 |
| Molecular Weight | 121.11 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 4-amino-4-fluorobutanoic acid |
| SMILES | NC(F)CCC(=O)O |
| InChI | InChI=1S/C4H8FNO2/c5-3(6)1-2-4(7)8/h3H,1-2,6H2,(H,7,8) |
| InChIKey | SQFUZDVFQHXHFR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-fluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-fluorobutanoic acid?
The IUPAC name of 4-amino-4-fluorobutanoic acid (CID 20508342) is 4-amino-4-fluorobutanoic acid.
What is the SMILES notation for 4-amino-4-fluorobutanoic acid?
The canonical SMILES for 4-amino-4-fluorobutanoic acid is NC(F)CCC(=O)O.
What is the InChIKey of 4-amino-4-fluorobutanoic acid?
The InChIKey is SQFUZDVFQHXHFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO2/c5-3(6)1-2-4(7)8/h3H,1-2,6H2,(H,7,8).
What are the key properties of 4-amino-4-fluorobutanoic acid?
4-amino-4-fluorobutanoic acid has a molecular weight of 121.11 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-fluorobutanoic acid is sourced from PubChem (CID 20508342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).