About 4-amino-4-hydroxybutanoic acid;palladium
4-amino-4-hydroxybutanoic acid;palladium (PubChem CID 87204989) has the molecular formula C4H9NO3Pd
and a molecular weight of 225.54 g/mol. Its IUPAC name is 4-amino-4-hydroxybutanoic acid;palladium.
Molecular Properties
| Compound Name | 4-amino-4-hydroxybutanoic acid;palladium |
| PubChem CID | 87204989 |
| Molecular Formula | C4H9NO3Pd |
| Molecular Weight | 225.54 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | 4-amino-4-hydroxybutanoic acid;palladium |
| SMILES | NC(O)CCC(=O)O.[Pd] |
| InChI | InChI=1S/C4H9NO3.Pd/c5-3(6)1-2-4(7)8;/h3,6H,1-2,5H2,(H,7,8); |
| InChIKey | NHMAABGSUILALU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.54 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-hydroxybutanoic acid;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-hydroxybutanoic acid;palladium?
The IUPAC name of 4-amino-4-hydroxybutanoic acid;palladium (CID 87204989) is 4-amino-4-hydroxybutanoic acid;palladium.
What is the SMILES notation for 4-amino-4-hydroxybutanoic acid;palladium?
The canonical SMILES for 4-amino-4-hydroxybutanoic acid;palladium is NC(O)CCC(=O)O.[Pd].
What is the InChIKey of 4-amino-4-hydroxybutanoic acid;palladium?
The InChIKey is NHMAABGSUILALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.Pd/c5-3(6)1-2-4(7)8;/h3,6H,1-2,5H2,(H,7,8);.
What are the key properties of 4-amino-4-hydroxybutanoic acid;palladium?
4-amino-4-hydroxybutanoic acid;palladium has a molecular weight of 225.54 g/mol, XLogP of -0.87, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-hydroxybutanoic acid;palladium is sourced from PubChem (CID 87204989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).