C16H17N3O4S — CID 3418779
N-(4-ethoxyphenyl)-N-ethyl-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 3418779) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N-ethyl-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-N-ethyl-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 3418779 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(4-ethoxyphenyl)-N-ethyl-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CCOc1ccc(N(CC)S(=O)(=O)c2cccc3nonc23)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-3-19(12-8-10-13(11-9-12)22-4-2)24(20,21)15-7-5-6-14-16(15)18-23-17-14/h5-11H,3-4H2,1-2H3 |
| InChIKey | CRWYBKWRTXWZEE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|