C23H17F3N2O4S — CID 3419088
[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3419088) has the molecular formula C23H17F3N2O4S and a molecular weight of 474.46 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3419088 |
| Molecular Formula | C23H17F3N2O4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc(-n2nc(-c3ccccc3)cc2OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H17F3N2O4S/c1-31-19-12-10-18(11-13-19)28-22(15-21(27-28)16-6-3-2-4-7-16)32-33(29,30)20-9-5-8-17(14-20)23(24,25)26/h2-15H,1H3 |
| InChIKey | VFUNWXAKARLFIH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|