C25H18N2O3S — CID 42726775
(1,3-diphenylpyrazol-5-yl) naphthalene-2-sulfonate (PubChem CID 42726775) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-5-yl) naphthalene-2-sulfonate.
| Compound Name | (1,3-diphenylpyrazol-5-yl) naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 42726775 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (1,3-diphenylpyrazol-5-yl) naphthalene-2-sulfonate |
| SMILES | O=S(=O)(Oc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H18N2O3S/c28-31(29,23-16-15-19-9-7-8-12-21(19)17-23)30-25-18-24(20-10-3-1-4-11-20)26-27(25)22-13-5-2-6-14-22/h1-18H |
| InChIKey | ICSMVBJNZQIYPA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|