C28H41N3O3S — CID 3419320
2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide (PubChem CID 3419320) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3419320 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CCCCNc1nc2c(s1)CC1C(C)(CO)C(O)CCC1(C)C2CC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C28H41N3O3S/c1-5-6-14-29-26-31-25-20(15-24(34)30-18(2)19-10-8-7-9-11-19)27(3)13-12-23(33)28(4,17-32)22(27)16-21(25)35-26/h7-11,18,20,22-23,32-33H,5-6,12-17H2,1-4H3,(H,29,31)(H,30,34) |
| InChIKey | CBEBCEXWIRVPCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|