C30H37N3O3S — CID 4646190
2-[2-anilino-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide (PubChem CID 4646190) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is 2-[2-anilino-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[2-anilino-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4646190 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-[2-anilino-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CC1c2nc(Nc3ccccc3)sc2CC2C(C)(CO)C(O)CCC12C)c1ccccc1 |
| InChI | InChI=1S/C30H37N3O3S/c1-19(20-10-6-4-7-11-20)31-26(36)16-22-27-23(37-28(33-27)32-21-12-8-5-9-13-21)17-24-29(22,2)15-14-25(35)30(24,3)18-34/h4-13,19,22,24-25,34-35H,14-18H2,1-3H3,(H,31,36)(H,32,33) |
| InChIKey | PQDZUZYLEZCMDY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |