C25H36N4O3S — CID 3677316
N,N-diethyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-(pyridin-3-ylamino)-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide (PubChem CID 3677316) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is N,N-diethyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-(pyridin-3-ylamino)-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide.
| Compound Name | N,N-diethyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-(pyridin-3-ylamino)-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 3677316 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N,N-diethyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-(pyridin-3-ylamino)-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide |
| SMILES | CCN(CC)C(=O)CC1c2nc(Nc3cccnc3)sc2CC2C(C)(CO)C(O)CCC12C |
| InChI | InChI=1S/C25H36N4O3S/c1-5-29(6-2)21(32)12-17-22-18(33-23(28-22)27-16-8-7-11-26-14-16)13-19-24(17,3)10-9-20(31)25(19,4)15-30/h7-8,11,14,17,19-20,30-31H,5-6,9-10,12-13,15H2,1-4H3,(H,27,28) |
| InChIKey | IAEKXQBVMAKSHL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |