C23H39N3O4S — CID 3724611
2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 3724611) has the molecular formula C23H39N3O4S and a molecular weight of 453.65 g/mol. Its IUPAC name is 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3724611 |
| Molecular Formula | C23H39N3O4S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-[2-(butylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCNc1nc2c(s1)CC1C(C)(CO)C(O)CCC1(C)C2CC(=O)NCCOC |
| InChI | InChI=1S/C23H39N3O4S/c1-5-6-9-25-21-26-20-15(12-19(29)24-10-11-30-4)22(2)8-7-18(28)23(3,14-27)17(22)13-16(20)31-21/h15,17-18,27-28H,5-14H2,1-4H3,(H,24,29)(H,25,26) |
| InChIKey | DFZABXGZNYQXHA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|